What is the molecular formula of 2-Fluorobenzotrifluoride?
The molecular formula of 2-Fluorobenzotrifluoride is C7H4F4.
What is the molecular weight of 2-Fluorobenzotrifluoride?
The molecular weight of 2-Fluorobenzotrifluoride is 164.10 g/mol.
What is the IUPAC name of 2-Fluorobenzotrifluoride?
The IUPAC name of 2-Fluorobenzotrifluoride is 1-fluoro-2-(trifluoromethyl)benzene.
What is the InChI of 2-Fluorobenzotrifluoride?
The InChI of 2-Fluorobenzotrifluoride is InChI=1S/C7H4F4/c8-6-4-2-1-3-5(6)7(9,10)11/h1-4H.
What is the InChIKey of 2-Fluorobenzotrifluoride?
The InChIKey of 2-Fluorobenzotrifluoride is BGVGHYOIWIALFF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluorobenzotrifluoride?
The canonical SMILES of 2-Fluorobenzotrifluoride is C1=CC=C(C(=C1)C(F)(F)F)F.
What is the CAS number of 2-Fluorobenzotrifluoride?
The CAS number of 2-Fluorobenzotrifluoride is 392-85-8.
What is the European Community (EC) number of 2-Fluorobenzotrifluoride?
The European Community (EC) number of 2-Fluorobenzotrifluoride is 206-880-4.
How many hydrogen bond donor counts does 2-Fluorobenzotrifluoride have?
2-Fluorobenzotrifluoride has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Fluorobenzotrifluoride have?
2-Fluorobenzotrifluoride has 4 hydrogen bond acceptor counts.