What is the PubChem CID of 2-Fluoroanisole?
PubChem CID 67576.
What is the molecular formula of 2-Fluoroanisole?
The molecular formula is C7H7FO.
What is the molecular weight of 2-Fluoroanisole?
The molecular weight is 126.13 g/mol.
What is the IUPAC name of 2-Fluoroanisole?
The IUPAC name is 1-fluoro-2-methoxybenzene.
What is the InChI of 2-Fluoroanisole?
The InChI is InChI=1S/C7H7FO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3.
What is the InChIKey of 2-Fluoroanisole?
The InChIKey is JIXDOBAQOWOUPA-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoroanisole?
The canonical SMILES is COC1=CC=CC=C1F.
What is the CAS number of 2-Fluoroanisole?
The CAS number is 321-28-8.
What is the XLogP3 value of 2-Fluoroanisole?
The XLogP3 value is 2.1.
Is 2-Fluoroanisole a canonicalized compound?
Yes, 2-Fluoroanisole is canonicalized.