What is the molecular formula of 2-Ethylhexyl bromide?
The molecular formula is C8H17Br.
What is the molecular weight of 2-Ethylhexyl bromide?
The molecular weight is 193.12 g/mol.
What is the IUPAC name of 2-Ethylhexyl bromide?
The IUPAC name is 3-(bromomethyl)heptane.
What is the InChI of 2-Ethylhexyl bromide?
The InChI is InChI=1S/C8H17Br/c1-3-5-6-8(4-2)7-9/h8H,3-7H2,1-2H3.
What is the InChIKey of 2-Ethylhexyl bromide?
The InChIKey is NZWIYPLSXWYKLH-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Ethylhexyl bromide?
The canonical SMILES is CCCCC(CC)CBr.
What is the CAS number of 2-Ethylhexyl bromide?
The CAS number is 18908-66-2.
What is the EC number of 2-Ethylhexyl bromide?
The EC number is 242-659-9.
What is the UNII of 2-Ethylhexyl bromide?
The UNII is N280JW4C4W.
Is 2-Ethylhexyl bromide a canonicalized compound?
Yes, 2-Ethylhexyl bromide is a canonicalized compound.