What is the chemical formula of 2-Ethylanthracene?
The chemical formula of 2-Ethylanthracene is C16H14.
What is the molecular weight of 2-Ethylanthracene?
The molecular weight of 2-Ethylanthracene is 206.28 g/mol.
What is the IUPAC name of 2-Ethylanthracene?
The IUPAC name of 2-Ethylanthracene is 2-ethylanthracene.
What is the InChI of 2-Ethylanthracene?
The InChI of 2-Ethylanthracene is InChI=1S/C16H14/c1-2-12-7-8-15-10-13-5-3-4-6-14(13)11-16(15)9-12/h3-11H,2H2,1H3.
What is the InChIKey of 2-Ethylanthracene?
The InChIKey of 2-Ethylanthracene is ZXAGXLDEMUNQSH-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2-Ethylanthracene?
The canonical SMILES representation of 2-Ethylanthracene is CCC1=CC2=CC3=CC=CC=C3C=C2C=C1.
What is the CAS number of 2-Ethylanthracene?
The CAS number of 2-Ethylanthracene is 52251-71-5.
What is the European Community (EC) number of 2-Ethylanthracene?
The European Community (EC) number of 2-Ethylanthracene is 257-788-6.
Is 2-Ethylanthracene a canonicalized compound?
Yes, 2-Ethylanthracene is a canonicalized compound according to PubChem.