What is the PubChem CID for 2-Ethoxy-3-methylpyridine-5-boronic acid?
The PubChem CID is 53216330.
What is the molecular formula of 2-Ethoxy-3-methylpyridine-5-boronic acid?
The molecular formula is C8H12BNO3.
What are the synonyms for 2-Ethoxy-3-methylpyridine-5-boronic acid?
The synonyms include "2-ETHOXY-3-METHYLPYRIDINE-5-BORONIC ACID," "1451391-77-7," "(6-Ethoxy-5-methylpyridin-3-yl)boronic acid," "MFCD13181608," and "AKOS022181750."
What is the molecular weight of 2-Ethoxy-3-methylpyridine-5-boronic acid?
The molecular weight is 181.00 g/mol.
What is the IUPAC name of 2-Ethoxy-3-methylpyridine-5-boronic acid?
The IUPAC name is "(6-ethoxy-5-methylpyridin-3-yl)boronic acid."
What is the InChI of 2-Ethoxy-3-methylpyridine-5-boronic acid?
The InChI is "InChI=1S/C8H12BNO3/c1-3-13-8-6(2)4-7(5-10-8)9(11)12/h4-5,11-12H,3H2,1-2H3."
What is the InChIKey of 2-Ethoxy-3-methylpyridine-5-boronic acid?
The InChIKey is "SFGDPXBBFQWHEF-UHFFFAOYSA-N."
What is the canonical SMILES of 2-Ethoxy-3-methylpyridine-5-boronic acid?
The canonical SMILES is "B(C1=CC(=C(N=C1)OCC)C)(O)O."
What is the hydrogen bond donor count of 2-Ethoxy-3-methylpyridine-5-boronic acid?
The hydrogen bond donor count is 2.
What is the hydrogen bond acceptor count of 2-Ethoxy-3-methylpyridine-5-boronic acid?
The hydrogen bond acceptor count is 4.
※ Please kindly note that our products are for research use only.