What is the PubChem CID of 2-Cyanobenzyl bromide?
The PubChem CID of 2-Cyanobenzyl bromide is 89599.
What is the molecular formula of 2-Cyanobenzyl bromide?
The molecular formula of 2-Cyanobenzyl bromide is C8H6BrN.
What is the molecular weight of 2-Cyanobenzyl bromide?
The molecular weight of 2-Cyanobenzyl bromide is 196.04 g/mol.
When was the compound created and modified?
The compound was created on March 27, 2005, and last modified on December 2, 2023.
What is the IUPAC name of 2-Cyanobenzyl bromide?
The IUPAC name of 2-Cyanobenzyl bromide is 2-(bromomethyl)benzonitrile.
What is the InChI of 2-Cyanobenzyl bromide?
The InChI of 2-Cyanobenzyl bromide is "InChI=1S/C8H6BrN/c9-5-7-3-1-2-4-8(7)6-10/h1-4H,5H2".
What is the InChIKey of 2-Cyanobenzyl bromide?
The InChIKey of 2-Cyanobenzyl bromide is "QGXNHCXKWFNKCG-UHFFFAOYSA-N".
What is the canonical SMILES of 2-Cyanobenzyl bromide?
The canonical SMILES of 2-Cyanobenzyl bromide is "C1=CC=C(C(=C1)CBr)C#N".
What is the CAS number of 2-Cyanobenzyl bromide?
The CAS number of 2-Cyanobenzyl bromide is 22115-41-9.
Is 2-Cyanobenzyl bromide a covalently-bonded unit?
Yes, 2-Cyanobenzyl bromide is a covalently-bonded unit.