What is the molecular formula of 4-Bromo-2-chlorotoluene?
The molecular formula of 4-Bromo-2-chlorotoluene is C7H6BrCl.
What is the molecular weight of 4-Bromo-2-chlorotoluene?
The molecular weight of 4-Bromo-2-chlorotoluene is 205.48 g/mol.
What is the IUPAC name of 4-Bromo-2-chlorotoluene?
The IUPAC name of 4-Bromo-2-chlorotoluene is 4-bromo-2-chloro-1-methylbenzene.
What is the InChI of 4-Bromo-2-chlorotoluene?
The InChI of 4-Bromo-2-chlorotoluene is InChI=1S/C7H6BrCl/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3.
What is the InChIKey of 4-Bromo-2-chlorotoluene?
The InChIKey of 4-Bromo-2-chlorotoluene is LIFMTDJMLRECMX-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-2-chlorotoluene?
The canonical SMILES of 4-Bromo-2-chlorotoluene is CC1=C(C=C(C=C1)Br)Cl.
What is the CAS number of 4-Bromo-2-chlorotoluene?
The CAS number of 4-Bromo-2-chlorotoluene is 89794-02-5.
What is the European Community (EC) number of 4-Bromo-2-chlorotoluene?
The European Community (EC) number of 4-Bromo-2-chlorotoluene is 629-393-2.
What is the DSSTox Substance ID of 4-Bromo-2-chlorotoluene?
The DSSTox Substance ID of 4-Bromo-2-chlorotoluene is DTXSID20370792.
Is 4-Bromo-2-chlorotoluene a canonicalized compound?
Yes, 4-Bromo-2-chlorotoluene is a canonicalized compound.