What is the IUPAC name of the compound with PubChem CID 69449?
The IUPAC name of the compound is 2-chloro-4-methylquinoline.
What is the molecular formula of the compound?
The molecular formula of the compound is C10H8ClN.
What is the molecular weight of the compound?
The molecular weight of the compound is 177.63 g/mol.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C10H8ClN/c1-7-6-10(11)12-9-5-3-2-4-8(7)9/h2-6H,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is PFEIMKNQOIFKSW-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=CC(=NC2=CC=CC=C12)Cl.
What is the CAS number of the compound?
The CAS number of the compound is 634-47-9.
What is the EC number of the compound?
The EC number of the compound is 211-209-3.
What is the UNII of the compound?
The UNII of the compound is 2U5ATH9EJR.
Does the compound have a defined atom stereocenter count?
No, the compound does not have a defined atom stereocenter count.