What is the molecular formula of 2-Chlorobenzotrichloride?
The molecular formula of 2-Chlorobenzotrichloride is C7H4Cl4.
What is the molecular weight of 2-Chlorobenzotrichloride?
The molecular weight of 2-Chlorobenzotrichloride is 229.9 g/mol.
What is the IUPAC name of 2-Chlorobenzotrichloride?
The IUPAC name of 2-Chlorobenzotrichloride is 1-chloro-2-(trichloromethyl)benzene.
What is the InChI of 2-Chlorobenzotrichloride?
The InChI of 2-Chlorobenzotrichloride is InChI=1S/C7H4Cl4/c8-6-4-2-1-3-5(6)7(9,10)11/h1-4H.
What is the InChIKey of 2-Chlorobenzotrichloride?
The InChIKey of 2-Chlorobenzotrichloride is MFHPYLFZSCSNST-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chlorobenzotrichloride?
The canonical SMILES of 2-Chlorobenzotrichloride is C1=CC=C(C(=C1)C(Cl)(Cl)Cl)Cl.
What is the CAS number of 2-Chlorobenzotrichloride?
The CAS number of 2-Chlorobenzotrichloride is 2136-89-2.
What is the European Community (EC) number of 2-Chlorobenzotrichloride?
The European Community (EC) number of 2-Chlorobenzotrichloride is 218-377-7.
What is the hydrogen bond donor count of 2-Chlorobenzotrichloride?
The hydrogen bond donor count of 2-Chlorobenzotrichloride is 0.
Is 2-Chlorobenzotrichloride a canonicalized compound?
Yes, 2-Chlorobenzotrichloride is a canonicalized compound according to PubChem.