What is the molecular formula of 2-chloro-5-nitropyrazine?
The molecular formula of 2-chloro-5-nitropyrazine is C4H2ClN3O2.
When was 2-chloro-5-nitropyrazine created?
2-chloro-5-nitropyrazine was created on July 11, 2005.
What is the molecular weight of 2-chloro-5-nitropyrazine?
The molecular weight of 2-chloro-5-nitropyrazine is 159.53 g/mol.
What is the IUPAC name of 2-chloro-5-nitropyrazine?
The IUPAC name of 2-chloro-5-nitropyrazine is 2-chloro-5-nitropyrazine.
How many hydrogen bond acceptor counts are there in 2-chloro-5-nitropyrazine?
There are 4 hydrogen bond acceptor counts in 2-chloro-5-nitropyrazine.
What is the canonical SMILES representation of 2-chloro-5-nitropyrazine?
The canonical SMILES representation of 2-chloro-5-nitropyrazine is C1=C(N=CC(=N1)Cl)[N+](=O)[O-].
What is the topological polar surface area of 2-chloro-5-nitropyrazine?
The topological polar surface area of 2-chloro-5-nitropyrazine is 71.6 Ų.
Is 2-chloro-5-nitropyrazine a covalently-bonded unit?
Yes, 2-chloro-5-nitropyrazine is a covalently-bonded unit.
What is the InChIKey of 2-chloro-5-nitropyrazine?
The InChIKey of 2-chloro-5-nitropyrazine is LONXFNWBWBLJNP-UHFFFAOYSA-N.
How many rotatable bond counts are there in 2-chloro-5-nitropyrazine?
There are 0 rotatable bond counts in 2-chloro-5-nitropyrazine.