What is the molecular formula of 2-Chloro-5-nitroaniline?
The molecular formula is C6H5ClN2O2.
What is the molecular weight of 2-Chloro-5-nitroaniline?
The molecular weight is 172.57 g/mol.
What is the IUPAC name of 2-Chloro-5-nitroaniline?
The IUPAC name is 2-chloro-5-nitroaniline.
What is the InChI key of 2-Chloro-5-nitroaniline?
The InChI key is KWIXNFOTNVKIGM-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2-Chloro-5-nitroaniline?
The canonical SMILES is C1=CC(=C(C=C1[N+](=O)[O-])N)Cl.
What is the CAS number of 2-Chloro-5-nitroaniline?
The CAS number is 6283-25-6.
What is the EC number of 2-Chloro-5-nitroaniline?
The EC number is 228-498-7.
What is the ChEMBL ID of 2-Chloro-5-nitroaniline?
The ChEMBL ID is CHEMBL325115.
What is the XLogP3 value of 2-Chloro-5-nitroaniline?
The XLogP3 value is 2.1.
How many heavy atoms are present in 2-Chloro-5-nitroaniline?
There are 11 heavy atoms in 2-Chloro-5-nitroaniline.