What is the molecular formula of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid?
The molecular formula of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid is C7H3ClF2O4S.
What are the synonyms for 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid?
The synonyms for 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid include 1644451-41-1, 2-CHLORO-5-FLUOROSULFONYL-4-FLUOROBENZOIC ACID, 2-chloro-4-fluoro-5-fluorosulfonylbenzoic acid, and AKOS037478162.
What is the molecular weight of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid?
The molecular weight of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid is 256.61 g/mol.
What is the IUPAC name of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid?
The IUPAC name of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid is 2-chloro-4-fluoro-5-fluorosulfonylbenzoic acid.
What is the InChI representation of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid?
The InChI representation of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid is InChI=1S/C7H3ClF2O4S/c8-4-2-5(9)6(15(10,13)14)1-3(4)7(11)12/h1-2H,(H,11,12).
What is the InChIKey of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid?
The InChIKey of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid is MZQDRBXCSOVJDM-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid?
The Canonical SMILES of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid is C1=C(C(=CC(=C1S(=O)(=O)F)F)Cl)C(=O)O.
What is the XLogP3-AA value of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid?
The XLogP3-AA value of 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid is 2.
How many hydrogen bond donor counts does 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid have?
2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid have?
2-Chloro-5-fluorosulfonyl-4-fluorobenzoic acid has 6 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.