What is the molecular formula of 2-Chloro-4-fluoroaniline?
The molecular formula of 2-Chloro-4-fluoroaniline is C6H5ClFN.
What is the molecular weight of 2-Chloro-4-fluoroaniline?
The molecular weight of 2-Chloro-4-fluoroaniline is 145.56 g/mol.
What is the IUPAC name of 2-Chloro-4-fluoroaniline?
The IUPAC name of 2-Chloro-4-fluoroaniline is 2-chloro-4-fluoroaniline.
What is the InChI of 2-Chloro-4-fluoroaniline?
The InChI of 2-Chloro-4-fluoroaniline is InChI=1S/C6H5ClFN/c7-5-3-4(8)1-2-6(5)9/h1-3H,9H2.
What is the InChIKey of 2-Chloro-4-fluoroaniline?
The InChIKey of 2-Chloro-4-fluoroaniline is XRAKCYJTJGTSMM-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-4-fluoroaniline?
The canonical SMILES of 2-Chloro-4-fluoroaniline is C1=CC(=C(C=C1F)Cl)N.
What is the CAS number of 2-Chloro-4-fluoroaniline?
The CAS number of 2-Chloro-4-fluoroaniline is 2106-02-7.
What is the European Community (EC) Number of 2-Chloro-4-fluoroaniline?
The European Community (EC) Number of 2-Chloro-4-fluoroaniline is 218-282-0.
What is the UNII of 2-Chloro-4-fluoroaniline?
The UNII of 2-Chloro-4-fluoroaniline is K77X364T56.
Is 2-Chloro-4-fluoroaniline a canonicalized compound?
Yes, 2-Chloro-4-fluoroaniline is a canonicalized compound.