What is the molecular formula of 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester?
The molecular formula of 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester is C12H17BClNO2.
When was 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester created?
2-Chloro-3-methylpyridine-4-boronic acid pinacol ester was created on November 27, 2010.
What is the molecular weight of 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester?
The molecular weight of 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester is 253.53 g/mol.
What is the IUPAC name of 2-Chloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine?
The IUPAC name of 2-Chloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is 2-chloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
What is the InChIKey of 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester?
The InChIKey of 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester is PERQITZETNXBGZ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester?
The canonical SMILES of 2-Chloro-3-methylpyridine-4-boronicacidpinacolester is B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)Cl)C.
How many hydrogen bond donor atoms are there in 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester?
There are 0 hydrogen bond donor atoms in 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester.
How many hydrogen bond acceptor atoms are there in 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester?
There are 3 hydrogen bond acceptor atoms in 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester.
How many rotatable bonds are there in 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester?
There is 1 rotatable bond in 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester.
Is 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester considered the canonical form?
Yes, 2-Chloro-3-methylpyridine-4-boronic acid pinacol ester is considered the canonical form.
※ Please kindly note that our products are for research use only.