What is the molecular formula of 2-Bromopyridin-4-ol?
The molecular formula of 2-Bromopyridin-4-ol is C5H4BrNO.
What is the molecular weight of 2-Bromopyridin-4-ol?
The molecular weight of 2-Bromopyridin-4-ol is 174.00 g/mol.
What is the IUPAC name of 2-Bromopyridin-4-ol?
The IUPAC name of 2-Bromopyridin-4-ol is 2-bromo-1H-pyridin-4-one.
What is the InChI of 2-Bromopyridin-4-ol?
The InChI of 2-Bromopyridin-4-ol is InChI=1S/C5H4BrNO/c6-5-3-4(8)1-2-7-5/h1-3H,(H,7,8).
What is the InChIKey of 2-Bromopyridin-4-ol?
The InChIKey of 2-Bromopyridin-4-ol is GGXSDQDNOMWAFV-UHFFFAOYSA-N.
What is the CAS number of 2-Bromopyridin-4-ol?
The CAS number of 2-Bromopyridin-4-ol is 36953-40-9.
What is the European Community (EC) number of 2-Bromopyridin-4-ol?
The European Community (EC) number of 2-Bromopyridin-4-ol is 818-609-2.
What is the XLogP3-AA value of 2-Bromopyridin-4-ol?
The XLogP3-AA value of 2-Bromopyridin-4-ol is 1.
Is 2-Bromopyridin-4-ol a canonicalized compound?
Yes, 2-Bromopyridin-4-ol is a canonicalized compound according to PubChem.