What is the chemical name of 2-Bromopropene?
The chemical name of 2-Bromopropene is 2-bromoprop-1-ene.
What is the molecular formula of 2-Bromopropene?
The molecular formula of 2-Bromopropene is C3H5Br.
What is the molecular weight of 2-Bromopropene?
The molecular weight of 2-Bromopropene is 120.98 g/mol.
What is the InChI of 2-Bromopropene?
The InChI of 2-Bromopropene is InChI=1S/C3H5Br/c1-3(2)4/h1H2,2H3.
What is the Canonical SMILES of 2-Bromopropene?
The Canonical SMILES of 2-Bromopropene is CC(=C)Br.
What is the CAS number of 2-Bromopropene?
The CAS number of 2-Bromopropene is 557-93-7.
What is the European Community (EC) number of 2-Bromopropene?
The European Community (EC) number of 2-Bromopropene is 209-185-4.
What is the UNII code of 2-Bromopropene?
The UNII code of 2-Bromopropene is C8GT7P5ZZS.
What is the XLogP3-AA value of 2-Bromopropene?
The XLogP3-AA value of 2-Bromopropene is 1.9.
Is 2-Bromopropene a canonicalized compound in PubChem?
Yes, 2-Bromopropene is a canonicalized compound in PubChem.