What is the molecular formula of 2-Bromophenylacetic acid?
The molecular formula of 2-Bromophenylacetic acid is C8H7BrO2.
What is the molecular weight of 2-Bromophenylacetic acid?
The molecular weight of 2-Bromophenylacetic acid is 215.04 g/mol.
What is the IUPAC name of 2-Bromophenylacetic acid?
The IUPAC name of 2-Bromophenylacetic acid is 2-(2-bromophenyl)acetic acid.
What is the InChI of 2-Bromophenylacetic acid?
The InChI of 2-Bromophenylacetic acid is InChI=1S/C8H7BrO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2,(H,10,11).
What is the InChIKey of 2-Bromophenylacetic acid?
The InChIKey of 2-Bromophenylacetic acid is DWXSYDKEWORWBT-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromophenylacetic acid?
The canonical SMILES of 2-Bromophenylacetic acid is C1=CC=C(C(=C1)CC(=O)O)Br.
What is the CAS number of 2-Bromophenylacetic acid?
The CAS number of 2-Bromophenylacetic acid is 18698-97-0.
What is the XLogP3 value of 2-Bromophenylacetic acid?
The XLogP3 value of 2-Bromophenylacetic acid is 2.1.
How many hydrogen bond donor counts are there in 2-Bromophenylacetic acid?
There is 1 hydrogen bond donor count in 2-Bromophenylacetic acid.
How many hydrogen bond acceptor counts are there in 2-Bromophenylacetic acid?
There are 2 hydrogen bond acceptor counts in 2-Bromophenylacetic acid.