What is the molecular formula of 2-Bromoheptane?
The molecular formula of 2-Bromoheptane is C7H15Br.
What is the molecular weight of 2-Bromoheptane?
The molecular weight of 2-Bromoheptane is 179.10 g/mol.
What is the IUPAC name of 2-Bromoheptane?
The IUPAC name of 2-Bromoheptane is 2-bromoheptane.
What is the InChI of 2-Bromoheptane?
The InChI of 2-Bromoheptane is InChI=1S/C7H15Br/c1-3-4-5-6-7(2)8/h7H,3-6H2,1-2H3.
What is the InChIKey of 2-Bromoheptane?
The InChIKey of 2-Bromoheptane is HLAUCEOFCOXKNF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromoheptane?
The canonical SMILES of 2-Bromoheptane is CCCCCC(C)Br.
What is the CAS number of 2-Bromoheptane?
The CAS number of 2-Bromoheptane is 1974-04-5.
What is the XLogP3 value of 2-Bromoheptane?
The XLogP3 value of 2-Bromoheptane is 3.8.
How many rotatable bonds does 2-Bromoheptane have?
2-Bromoheptane has 4 rotatable bonds.
Is 2-Bromoheptane a canonicalized compound?
Yes, 2-Bromoheptane is a canonicalized compound according to PubChem.