What is the molecular formula of 2-Bromobenzaldehyde?
The molecular formula of 2-Bromobenzaldehyde is C7H5BrO.
What is the molecular weight of 2-Bromobenzaldehyde?
The molecular weight of 2-Bromobenzaldehyde is 185.02 g/mol.
What is the IUPAC name of 2-Bromobenzaldehyde?
The IUPAC name of 2-Bromobenzaldehyde is 2-bromobenzaldehyde.
What is the InChI of 2-Bromobenzaldehyde?
The InChI of 2-Bromobenzaldehyde is InChI=1S/C7H5BrO/c8-7-4-2-1-3-6(7)5-9/h1-5H.
What is the InChIKey of 2-Bromobenzaldehyde?
The InChIKey of 2-Bromobenzaldehyde is NDOPHXWIAZIXPR-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromobenzaldehyde?
The canonical SMILES of 2-Bromobenzaldehyde is C1=CC=C(C(=C1)C=O)Br.
What is the CAS number of 2-Bromobenzaldehyde?
The CAS number of 2-Bromobenzaldehyde is 6630-33-7.
What is the EC number of 2-Bromobenzaldehyde?
The EC number of 2-Bromobenzaldehyde is 229-622-2.
What is the ChEMBL ID of 2-Bromobenzaldehyde?
The ChEMBL ID of 2-Bromobenzaldehyde is CHEMBL3236916.
Is 2-Bromobenzaldehyde a canonicalized compound?
Yes, 2-Bromobenzaldehyde is a canonicalized compound.