What is the PubChem CID of 2-Bromoacetamide?
The PubChem CID of 2-Bromoacetamide is 69632.
What is the molecular formula of 2-Bromoacetamide?
The molecular formula of 2-Bromoacetamide is C2H4BrNO.
What is the molecular weight of 2-Bromoacetamide?
The molecular weight of 2-Bromoacetamide is 137.96 g/mol.
What is the IUPAC name of 2-Bromoacetamide?
The IUPAC name of 2-Bromoacetamide is 2-bromoacetamide.
What is the InChI of 2-Bromoacetamide?
The InChI of 2-Bromoacetamide is InChI=1S/C2H4BrNO/c3-1-2(4)5/h1H2,(H2,4,5).
What is the InChIKey of 2-Bromoacetamide?
The InChIKey of 2-Bromoacetamide is JUIKUQOUMZUFQT-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Bromoacetamide?
The Canonical SMILES of 2-Bromoacetamide is C(C(=O)N)Br.
What is the CAS number of 2-Bromoacetamide?
The CAS number of 2-Bromoacetamide is 683-57-8.
What is the XLogP3 value of 2-Bromoacetamide?
The XLogP3 value of 2-Bromoacetamide is -0.5.
Is 2-Bromoacetamide a canonicalized compound?
Yes, 2-Bromoacetamide is a canonicalized compound.