What is the molecular formula of 2-Bromo-N-methylaniline?
The molecular formula of 2-Bromo-N-methylaniline is C7H8BrN.
What is the molecular weight of 2-Bromo-N-methylaniline?
The molecular weight of 2-Bromo-N-methylaniline is 186.05 g/mol.
What is the IUPAC name of 2-Bromo-N-methylaniline?
The IUPAC name of 2-Bromo-N-methylaniline is 2-bromo-N-methylaniline.
What is the InChI of 2-Bromo-N-methylaniline?
The InChI of 2-Bromo-N-methylaniline is InChI=1S/C7H8BrN/c1-9-7-5-3-2-4-6(7)8/h2-5,9H,1H3.
What is the InChIKey of 2-Bromo-N-methylaniline?
The InChIKey of 2-Bromo-N-methylaniline is SMVIAQFTVWDWDS-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-N-methylaniline?
The canonical SMILES of 2-Bromo-N-methylaniline is CNC1=CC=CC=C1Br.
What is the CAS number of 2-Bromo-N-methylaniline?
The CAS number of 2-Bromo-N-methylaniline is 6832-87-7.
What is the XLogP3-AA value of 2-Bromo-N-methylaniline?
The XLogP3-AA value of 2-Bromo-N-methylaniline is 2.6.
Is 2-Bromo-N-methylaniline a canonicalized compound?
Yes, 2-Bromo-N-methylaniline is a canonicalized compound.