What is the molecular formula of 2-Bromo-5-fluorotoluene?
The molecular formula of 2-Bromo-5-fluorotoluene is C7H6BrF.
What is the molecular weight of 2-Bromo-5-fluorotoluene?
The molecular weight of 2-Bromo-5-fluorotoluene is 189.02 g/mol.
What is the IUPAC name of 2-Bromo-5-fluorotoluene?
The IUPAC name of 2-Bromo-5-fluorotoluene is 1-bromo-4-fluoro-2-methylbenzene.
What is the InChI of 2-Bromo-5-fluorotoluene?
The InChI of 2-Bromo-5-fluorotoluene is InChI=1S/C7H6BrF/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3.
What is the InChIKey of 2-Bromo-5-fluorotoluene?
The InChIKey of 2-Bromo-5-fluorotoluene is RJPNVPITBYXBNB-UHFFFAOYSA-N.
What is the CAS number of 2-Bromo-5-fluorotoluene?
The CAS number of 2-Bromo-5-fluorotoluene is 452-63-1.
What is the European Community (EC) number of 2-Bromo-5-fluorotoluene?
The European Community (EC) number of 2-Bromo-5-fluorotoluene is 207-203-5.
What is the UNII of 2-Bromo-5-fluorotoluene?
The UNII of 2-Bromo-5-fluorotoluene is Z2EZM84G5X.
What is the DSSTox Substance ID of 2-Bromo-5-fluorotoluene?
The DSSTox Substance ID of 2-Bromo-5-fluorotoluene is DTXSID90196421.
What is the XLogP3 value of 2-Bromo-5-fluorotoluene?
The XLogP3 value of 2-Bromo-5-fluorotoluene is 3.7.