What is the molecular formula of 2-Bromo-5-fluoropyrazine?
The molecular formula is C4H2BrFN2.
What is the molecular weight of 2-Bromo-5-fluoropyrazine?
The molecular weight is 176.97 g/mol.
What is the IUPAC name of 2-Bromo-5-fluoropyrazine?
The IUPAC name is 2-bromo-5-fluoropyrazine.
What is the InChI of 2-Bromo-5-fluoropyrazine?
The InChI is InChI=1S/C4H2BrFN2/c5-3-1-8-4(6)2-7-3/h1-2H.
What is the InChIKey of 2-Bromo-5-fluoropyrazine?
The InChIKey is XPWYTZGWNXDFRE-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-5-fluoropyrazine?
The canonical SMILES is C1=C(N=CC(=N1)Br)F.
What is the CAS number of 2-Bromo-5-fluoropyrazine?
The CAS number is 1209459-10-8.
What is the EC number of 2-Bromo-5-fluoropyrazine?
The EC number is 810-677-1.
What is the hydrogen bond donor count of 2-Bromo-5-fluoropyrazine?
The hydrogen bond donor count is 0.
Is 2-Bromo-5-fluoropyrazine a canonicalized compound?
Yes, 2-Bromo-5-fluoropyrazine is a canonicalized compound.