What is the molecular formula of 2-Bromo-4-nitropyridine?
The molecular formula of 2-Bromo-4-nitropyridine is C5H3BrN2O2.
What is the molecular weight of 2-Bromo-4-nitropyridine?
The molecular weight of 2-Bromo-4-nitropyridine is 202.99 g/mol.
What is the IUPAC name of 2-Bromo-4-nitropyridine?
The IUPAC name of 2-Bromo-4-nitropyridine is 2-bromo-4-nitropyridine.
What is the InChI of 2-Bromo-4-nitropyridine?
The InChI of 2-Bromo-4-nitropyridine is InChI=1S/C5H3BrN2O2/c6-5-3-4(8(9)10)1-2-7-5/h1-3H.
What is the InChIKey of 2-Bromo-4-nitropyridine?
The InChIKey of 2-Bromo-4-nitropyridine is AFVITJKRFRRQKT-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-4-nitropyridine?
The canonical SMILES of 2-Bromo-4-nitropyridine is C1=CN=C(C=C1[N+](=O)[O-])Br.
What is the CAS number of 2-Bromo-4-nitropyridine?
The CAS number of 2-Bromo-4-nitropyridine is 6945-67-1.
What is the European Community (EC) number of 2-Bromo-4-nitropyridine?
The European Community (EC) number of 2-Bromo-4-nitropyridine is 627-225-2.
What is the DSSTox Substance ID of 2-Bromo-4-nitropyridine?
The DSSTox Substance ID of 2-Bromo-4-nitropyridine is DTXSID30287685.
Is 2-Bromo-4-nitropyridine a canonicalized compound?
Yes, 2-Bromo-4-nitropyridine is a canonicalized compound.