What is the molecular formula of 2-Bromo-4-fluorotoluene?
The molecular formula of 2-Bromo-4-fluorotoluene is C7H6BrF.
What is the molecular weight of 2-Bromo-4-fluorotoluene?
The molecular weight of 2-Bromo-4-fluorotoluene is 189.02 g/mol.
What is the IUPAC name of 2-Bromo-4-fluorotoluene?
The IUPAC name of 2-Bromo-4-fluorotoluene is 2-bromo-4-fluoro-1-methylbenzene.
What is the InChI of 2-Bromo-4-fluorotoluene?
The InChI of 2-Bromo-4-fluorotoluene is InChI=1S/C7H6BrF/c1-5-2-3-6(9)4-7(5)8/h2-4H,1H3.
What is the InChIKey of 2-Bromo-4-fluorotoluene?
The InChIKey of 2-Bromo-4-fluorotoluene is SFGFOJPGCOYQJK-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-4-fluorotoluene?
The canonical SMILES of 2-Bromo-4-fluorotoluene is CC1=C(C=C(C=C1)F)Br.
What is the CAS number of 2-Bromo-4-fluorotoluene?
The CAS number of 2-Bromo-4-fluorotoluene is 1422-53-3.
What is the European Community (EC) number of 2-Bromo-4-fluorotoluene?
The European Community (EC) number of 2-Bromo-4-fluorotoluene is 215-830-0.
What is the UNII of 2-Bromo-4-fluorotoluene?
The UNII of 2-Bromo-4-fluorotoluene is 9GVT2PZ9FR.
Is 2-Bromo-4-fluorotoluene a canonicalized compound?
Yes, 2-Bromo-4-fluorotoluene is a canonicalized compound.