What is the molecular formula of 2-Bromo-3-methoxypyridine-N-oxide?
The molecular formula of 2-Bromo-3-methoxypyridine-N-oxide is C6H6BrNO2.
What are the synonyms of 2-Bromo-3-methoxypyridine-N-oxide?
The synonyms of 2-Bromo-3-methoxypyridine-N-oxide include 2-Bromo-3-methoxypyridine-n-oxide, 104819-48-9, 2-bromo-3-methoxypyridine 1-oxide, 2-bromo-3-methoxy-1-oxidopyridin-1-ium, and 2-bromo-3-methoxypyridin-1-ium-1-olate.
What is the molecular weight of 2-Bromo-3-methoxypyridine-N-oxide?
The molecular weight of 2-Bromo-3-methoxypyridine-N-oxide is 204.02 g/mol.
What is the IUPAC name of 2-Bromo-3-methoxypyridine-N-oxide?
The IUPAC name of 2-Bromo-3-methoxypyridine-N-oxide is 2-bromo-3-methoxy-1-oxidopyridin-1-ium.
What is the InChI of 2-Bromo-3-methoxypyridine-N-oxide?
The InChI of 2-Bromo-3-methoxypyridine-N-oxide is InChI=1S/C6H6BrNO2/c1-10-5-3-2-4-8(9)6(5)7/h2-4H,1H3.
What is the InChIKey of 2-Bromo-3-methoxypyridine-N-oxide?
The InChIKey of 2-Bromo-3-methoxypyridine-N-oxide is HZSVGYDULFVJAB-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-3-methoxypyridine-N-oxide?
The canonical SMILES of 2-Bromo-3-methoxypyridine-N-oxide is COC1=C([N+](=CC=C1)[O-])Br.
What is the CAS number of 2-Bromo-3-methoxypyridine-N-oxide?
The CAS number of 2-Bromo-3-methoxypyridine-N-oxide is 104819-48-9.
Is 2-Bromo-3-methoxypyridine-N-oxide a canonicalized compound?
Yes, 2-Bromo-3-methoxypyridine-N-oxide is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.