What is the molecular formula of 2-Bromo-3-chloropyridine?
The molecular formula of 2-Bromo-3-chloropyridine is C5H3BrClN.
What is the molecular weight of 2-Bromo-3-chloropyridine?
The molecular weight of 2-Bromo-3-chloropyridine is 192.44 g/mol.
What is the IUPAC name of 2-Bromo-3-chloropyridine?
The IUPAC name of 2-Bromo-3-chloropyridine is 2-bromo-3-chloropyridine.
What is the InChI of 2-Bromo-3-chloropyridine?
The InChI of 2-Bromo-3-chloropyridine is InChI=1S/C5H3BrClN/c6-5-4(7)2-1-3-8-5/h1-3H.
What is the InChIKey of 2-Bromo-3-chloropyridine?
The InChIKey of 2-Bromo-3-chloropyridine is GOHBBINNYAWQGO-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-3-chloropyridine?
The canonical SMILES of 2-Bromo-3-chloropyridine is C1=CC(=C(N=C1)Br)Cl.
What is the CAS number of 2-Bromo-3-chloropyridine?
The CAS number of 2-Bromo-3-chloropyridine is 96424-68-9.
What is the European Community (EC) number of 2-Bromo-3-chloropyridine?
The European Community (EC) number of 2-Bromo-3-chloropyridine is 678-771-3.
Is 2-Bromo-3-chloropyridine a canonicalized compound?
Yes, 2-Bromo-3-chloropyridine is a canonicalized compound.