What is the molecular formula of 2-Bromo-1-benzofuran?
The molecular formula is C8H5BrO.
What is the molecular weight of 2-Bromo-1-benzofuran?
The molecular weight is 197.03 g/mol.
What is the IUPAC name of 2-Bromo-1-benzofuran?
The IUPAC name is 2-bromo-1-benzofuran.
What is the InChI of 2-Bromo-1-benzofuran?
The InChI is InChI=1S/C8H5BrO/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5H.
What is the InChIKey of 2-Bromo-1-benzofuran?
The InChIKey is RNEOFIVNTNLSEH-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-1-benzofuran?
The canonical SMILES is C1=CC=C2C(=C1)C=C(O2)Br.
What is the CAS number of 2-Bromo-1-benzofuran?
The CAS number is 54008-77-4.
What is the European Community (EC) number of 2-Bromo-1-benzofuran?
The European Community (EC) number is 830-348-6.
What is the ChEMBL ID of 2-Bromo-1-benzofuran?
The ChEMBL ID is CHEMBL3358222.
Is 2-Bromo-1-benzofuran a canonicalized compound?
Yes, 2-Bromo-1-benzofuran is a canonicalized compound.