What is the molecular formula of 2-Benzoyl-4-bromoaniline?
The molecular formula of 2-Benzoyl-4-bromoaniline is C13H10BrNO.
What is the molecular weight of 2-Benzoyl-4-bromoaniline?
The molecular weight of 2-Benzoyl-4-bromoaniline is 276.13 g/mol.
When was 2-Benzoyl-4-bromoaniline created in PubChem?
2-Benzoyl-4-bromoaniline was created in PubChem on March 26, 2005.
What is the InChI of 2-Benzoyl-4-bromoaniline?
The InChI of 2-Benzoyl-4-bromoaniline is InChI=1S/C13H10BrNO/c14-10-6-7-12(15)11(8-10)13(16)9-4-2-1-3-5-9/h1-8H,15H2.
What is the InChIKey of 2-Benzoyl-4-bromoaniline?
The InChIKey of 2-Benzoyl-4-bromoaniline is LXJVUGANBDAASB-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Benzoyl-4-bromoaniline?
The canonical SMILES of 2-Benzoyl-4-bromoaniline is C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Br)N.
What is the CAS number of 2-Benzoyl-4-bromoaniline?
The CAS number of 2-Benzoyl-4-bromoaniline is 39859-36-4.
What is the XLogP3-AA value of 2-Benzoyl-4-bromoaniline?
The XLogP3-AA value of 2-Benzoyl-4-bromoaniline is 3.8.
How many hydrogen bond donor counts does 2-Benzoyl-4-bromoaniline have?
2-Benzoyl-4-bromoaniline has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Benzoyl-4-bromoaniline have?
2-Benzoyl-4-bromoaniline has 2 hydrogen bond acceptor counts.