What is the molecular formula of 2-Aminophenethyl alcohol?
The molecular formula is C8H11NO.
What is the molecular weight of 2-Aminophenethyl alcohol?
The molecular weight is 137.18 g/mol.
What is the IUPAC name of 2-Aminophenethyl alcohol?
The IUPAC name is 2-(2-aminophenyl)ethanol.
What is the InChI of 2-Aminophenethyl alcohol?
The InChI is InChI=1S/C8H11NO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6,9H2.
What is the InChIKey of 2-Aminophenethyl alcohol?
The InChIKey is ILDXSRFKXABMHH-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2-Aminophenethyl alcohol?
The canonical SMILES is C1=CC=C(C(=C1)CCO)N.
What is the CAS number of 2-Aminophenethyl alcohol?
The CAS number is 5339-85-5.
What is the European Community (EC) number of 2-Aminophenethyl alcohol?
The European Community (EC) number is 226-275-9.
What is the ChEMBL ID of 2-Aminophenethyl alcohol?
The ChEMBL ID is CHEMBL4095436.
Is 2-Aminophenethyl alcohol a canonicalized compound?
Yes, it is canonicalized according to PubChem.