What is the molecular formula of 2-Amino-4-bromopyridine?
The molecular formula of 2-Amino-4-bromopyridine is C5H5BrN2.
What is the molecular weight of 2-Amino-4-bromopyridine?
The molecular weight of 2-Amino-4-bromopyridine is 173.01 g/mol.
What is the IUPAC name of 2-Amino-4-bromopyridine?
The IUPAC name of 2-Amino-4-bromopyridine is 4-bromopyridin-2-amine.
What is the InChI code of 2-Amino-4-bromopyridine?
The InChI code of 2-Amino-4-bromopyridine is InChI=1S/C5H5BrN2/c6-4-1-2-8-5(7)3-4/h1-3H,(H2,7,8).
What is the InChIKey of 2-Amino-4-bromopyridine?
The InChIKey of 2-Amino-4-bromopyridine is BAQKUNMKVAPWGU-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-4-bromopyridine?
The canonical SMILES of 2-Amino-4-bromopyridine is C1=CN=C(C=C1Br)N.
What is the CAS number of 2-Amino-4-bromopyridine?
The CAS number of 2-Amino-4-bromopyridine is 84249-14-9.
What is the XLogP3-AA value of 2-Amino-4-bromopyridine?
The XLogP3-AA value of 2-Amino-4-bromopyridine is 1.2.
How many hydrogen bond donor counts are there in 2-Amino-4-bromopyridine?
There is 1 hydrogen bond donor count in 2-Amino-4-bromopyridine.
How many hydrogen bond acceptor counts are there in 2-Amino-4-bromopyridine?
There are 2 hydrogen bond acceptor counts in 2-Amino-4-bromopyridine.