What is the molecular formula of 2-Amino-1-phenylethanol?
The molecular formula is C8H11NO.
What is the molecular weight of 2-Amino-1-phenylethanol?
The molecular weight is 137.18 g/mol.
What is the IUPAC name of 2-Amino-1-phenylethanol?
The IUPAC name is 2-amino-1-phenylethanol.
What is the CAS number of 2-Amino-1-phenylethanol?
The CAS number is 7568-93-6.
What is the InChI of 2-Amino-1-phenylethanol?
The InChI is InChI=1S/C8H11NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2.
What is the canonical SMILES of 2-Amino-1-phenylethanol?
The canonical SMILES is C1=CC=C(C=C1)C(CN)O.
What is the XLogP3 value of 2-Amino-1-phenylethanol?
The XLogP3 value is 0.1.
How many hydrogen bond donor counts does 2-Amino-1-phenylethanol have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Amino-1-phenylethanol have?
It has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of 2-Amino-1-phenylethanol?
The topological polar surface area is 46.2Ų.