What is the molecular formula of 2-Allylanisole?
The molecular formula of 2-Allylanisole is C10H12O.
What is the molecular weight of 2-Allylanisole?
The molecular weight of 2-Allylanisole is 148.20 g/mol.
What is the IUPAC name of 2-Allylanisole?
The IUPAC name of 2-Allylanisole is 1-methoxy-2-prop-2-enylbenzene.
What is the InChI of 2-Allylanisole?
The InChI of 2-Allylanisole is InChI=1S/C10H12O/c1-3-6-9-7-4-5-8-10(9)11-2/h3-5,7-8H,1,6H2,2H3.
What is the InChIKey of 2-Allylanisole?
The InChIKey of 2-Allylanisole is BCINBJDCXBFCDT-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Allylanisole?
The canonical SMILES of 2-Allylanisole is COC1=CC=CC=C1CC=C.
What is the CAS number of 2-Allylanisole?
The CAS number of 2-Allylanisole is 3698-28-0.
What is the EC number of 2-Allylanisole?
The EC number of 2-Allylanisole is 624-186-3.
What is the DSSTox Substance ID of 2-Allylanisole?
The DSSTox Substance ID of 2-Allylanisole is DTXSID30190468.
Is 2-Allylanisole considered a canonicalized compound?
Yes, 2-Allylanisole is considered a canonicalized compound.