What is the molecular formula of 2-Acetyl-4-bromophenol?
The molecular formula of 2-Acetyl-4-bromophenol is C8H7BrO2.
What is the molecular weight of 2-Acetyl-4-bromophenol?
The molecular weight of 2-Acetyl-4-bromophenol is 215.04 g/mol.
What is the IUPAC name of 2-Acetyl-4-bromophenol?
The IUPAC name of 2-Acetyl-4-bromophenol is 1-(5-bromo-2-hydroxyphenyl)ethanone.
What is the InChI of 2-Acetyl-4-bromophenol?
The InChI of 2-Acetyl-4-bromophenol is InChI=1S/C8H7BrO2/c1-5(10)7-4-6(9)2-3-8(7)11/h2-4,11H,1H3.
What is the InChIKey of 2-Acetyl-4-bromophenol?
The InChIKey of 2-Acetyl-4-bromophenol is HQCCNFFIOWYINW-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Acetyl-4-bromophenol?
The canonical SMILES of 2-Acetyl-4-bromophenol is CC(=O)C1=C(C=CC(=C1)Br)O.
What is the CAS number of 2-Acetyl-4-bromophenol?
The CAS number of 2-Acetyl-4-bromophenol is 1450-75-5.
What is the XlogP3 value of 2-Acetyl-4-bromophenol?
The XlogP3 value of 2-Acetyl-4-bromophenol is 2.7.
How many hydrogen bond donor counts are there in 2-Acetyl-4-bromophenol?
There is 1 hydrogen bond donor count in 2-Acetyl-4-bromophenol.
How many hydrogen bond acceptor counts are there in 2-Acetyl-4-bromophenol?
There are 2 hydrogen bond acceptor counts in 2-Acetyl-4-bromophenol.