What is the molecular formula of 2,6-Dimethoxytoluene?
The molecular formula of 2,6-Dimethoxytoluene is C9H12O2.
What is the molecular weight of 2,6-Dimethoxytoluene?
The molecular weight of 2,6-Dimethoxytoluene is 152.19 g/mol.
What is the IUPAC name of 2,6-Dimethoxytoluene?
The IUPAC name of 2,6-Dimethoxytoluene is 1,3-dimethoxy-2-methylbenzene.
What is the InChI of 2,6-Dimethoxytoluene?
The InChI of 2,6-Dimethoxytoluene is InChI=1S/C9H12O2/c1-7-8(10-2)5-4-6-9(7)11-3/h4-6H,1-3H3.
What is the InChIKey of 2,6-Dimethoxytoluene?
The InChIKey of 2,6-Dimethoxytoluene is FPEUDBGJAVKAEE-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Dimethoxytoluene?
The canonical SMILES of 2,6-Dimethoxytoluene is CC1=C(C=CC=C1OC)OC.
What is the CAS number of 2,6-Dimethoxytoluene?
The CAS number of 2,6-Dimethoxytoluene is 5673-07-4.
What is the European Community (EC) Number of 2,6-Dimethoxytoluene?
The European Community (EC) Number of 2,6-Dimethoxytoluene is 227-131-8.
What is the UNII of 2,6-Dimethoxytoluene?
The UNII of 2,6-Dimethoxytoluene is 3P2C6I4244.
Is 2,6-Dimethoxytoluene a canonical compound?
Yes, 2,6-Dimethoxytoluene is a canonical compound.