What is the molecular formula of 2,6-Difluoro-3-methylbenzyl bromide?
The molecular formula is C8H7BrF2.
What are the synonyms of 2,6-Difluoro-3-methylbenzyl bromide?
The synonyms include 2-(bromomethyl)-1,3-difluoro-4-methylbenzene, Benzene, 2-(bromomethyl)-1,3-difluoro-4-methyl-, and 2-Bromomethyl-1,3-difluoro-4-methyl-benzene.
What is the molecular weight of 2,6-Difluoro-3-methylbenzyl bromide?
The molecular weight is 221.04 g/mol.
What is the IUPAC name of 2,6-Difluoro-3-methylbenzyl bromide?
The IUPAC name is 2-(bromomethyl)-1,3-difluoro-4-methylbenzene.
What is the InChI of 2,6-Difluoro-3-methylbenzyl bromide?
The InChI is InChI=1S/C8H7BrF2/c1-5-2-3-7(10)6(4-9)8(5)11/h2-3H,4H2,1H3.
What is the InChIKey of 2,6-Difluoro-3-methylbenzyl bromide?
The InChIKey is IHFNXAURNLUMOH-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Difluoro-3-methylbenzyl bromide?
The canonical SMILES is CC1=C(C(=C(C=C1)F)CBr)F.
What is the CAS number of 2,6-Difluoro-3-methylbenzyl bromide?
The CAS number is 261763-44-4.
What is the European Community (EC) number of 2,6-Difluoro-3-methylbenzyl bromide?
The European Community (EC) number is 670-741-8.
What is the Monoisotopic Mass of 2,6-Difluoro-3-methylbenzyl bromide?
The Monoisotopic Mass is 219.96992 g/mol.
※ Please kindly note that our products are for research use only.