What is the molecular formula of 2,6-Dichlorobromobenzene?
The molecular formula of 2,6-Dichlorobromobenzene is C6H3BrCl2.
What is the molecular weight of 2,6-Dichlorobromobenzene?
The molecular weight of 2,6-Dichlorobromobenzene is 225.89 g/mol.
What is the IUPAC name of 2,6-Dichlorobromobenzene?
The IUPAC name of 2,6-Dichlorobromobenzene is 2-bromo-1,3-dichlorobenzene.
What is the InChI of 2,6-Dichlorobromobenzene?
The InChI of 2,6-Dichlorobromobenzene is InChI=1S/C6H3BrCl2/c7-6-4(8)2-1-3-5(6)9/h1-3H.
What is the InChIKey of 2,6-Dichlorobromobenzene?
The InChIKey of 2,6-Dichlorobromobenzene is UWOIDOQAQPUVOH-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Dichlorobromobenzene?
The canonical SMILES of 2,6-Dichlorobromobenzene is C1=CC(=C(C(=C1)Cl)Br)Cl.
What is the CAS number of 2,6-Dichlorobromobenzene?
The CAS number of 2,6-Dichlorobromobenzene is 19393-92-1.
What is the European Community (EC) number of 2,6-Dichlorobromobenzene?
The European Community (EC) number of 2,6-Dichlorobromobenzene is 243-018-6.
What is the DSSTox Substance ID of 2,6-Dichlorobromobenzene?
The DSSTox Substance ID of 2,6-Dichlorobromobenzene is DTXSID00173006.
Is 2,6-Dichlorobromobenzene a canonicalized compound?
Yes, 2,6-Dichlorobromobenzene is a canonicalized compound according to PubChem.