What is the molecular formula of 2,5-Dimethylanisole?
The molecular formula of 2,5-Dimethylanisole is C9H12O.
What is the molecular weight of 2,5-Dimethylanisole?
The molecular weight of 2,5-Dimethylanisole is 136.19 g/mol.
What is the IUPAC name of 2,5-Dimethylanisole?
The IUPAC name of 2,5-Dimethylanisole is 2-methoxy-1,4-dimethylbenzene.
What is the InChI of 2,5-Dimethylanisole?
The InChI of 2,5-Dimethylanisole is InChI=1S/C9H12O/c1-7-4-5-8(2)9(6-7)10-3/h4-6H,1-3H3.
What is the InChIKey of 2,5-Dimethylanisole?
The InChIKey of 2,5-Dimethylanisole is SJZAUIVYZWPNAS-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Dimethylanisole?
The canonical SMILES of 2,5-Dimethylanisole is CC1=CC(=C(C=C1)C)OC.
What is the CAS number of 2,5-Dimethylanisole?
The CAS number of 2,5-Dimethylanisole is 1706-11-2.
What is the European Community (EC) number of 2,5-Dimethylanisole?
The European Community (EC) number of 2,5-Dimethylanisole is 216-943-8.
What is the UNII of 2,5-Dimethylanisole?
The UNII of 2,5-Dimethylanisole is RH47BOM48G.
What is the XLogP3 value of 2,5-Dimethylanisole?
The XLogP3 value of 2,5-Dimethylanisole is 2.4.