What is the PubChem CID for 2,5-Difluoro thiophenol?
PubChem CID 3836323
What is the molecular formula of 2,5-Difluoro thiophenol?
The molecular formula is C6H4F2S.
What is the molecular weight of 2,5-Difluoro thiophenol?
The molecular weight is 146.16 g/mol.
What is the IUPAC name of 2,5-Difluoro thiophenol?
The IUPAC name is 2,5-difluorobenzenethiol.
What is the InChI of 2,5-Difluoro thiophenol?
The InChI is InChI=1S/C6H4F2S/c7-4-1-2-5(8)6(9)3-4/h1-3,9H.
What is the InChIKey of 2,5-Difluoro thiophenol?
The InChIKey is PQRVQUXEBQKVEQ-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,5-Difluoro thiophenol?
The Canonical SMILES is C1=CC(=C(C=C1F)S)F.
What is the CAS number of 2,5-Difluoro thiophenol?
The CAS number is 77380-28-0.
What is the XLogP3 value of 2,5-Difluoro thiophenol?
The XLogP3 value is 2.5.
Is 2,5-Difluoro thiophenol a canonicalized compound?
Yes, it is canonicalized according to PubChem.