What is the molecular formula of 2,5-Dibromopyridine?
The molecular formula of 2,5-Dibromopyridine is C5H3Br2N.
What is the molecular weight of 2,5-Dibromopyridine?
The molecular weight of 2,5-Dibromopyridine is 236.89 g/mol.
What is the IUPAC name of 2,5-Dibromopyridine?
The IUPAC name of 2,5-Dibromopyridine is 2,5-dibromopyridine.
What is the InChI of 2,5-Dibromopyridine?
The InChI of 2,5-Dibromopyridine is InChI=1S/C5H3Br2N/c6-4-1-2-5(7)8-3-4/h1-3H.
What is the InChIKey of 2,5-Dibromopyridine?
The InChIKey of 2,5-Dibromopyridine is ZHXUWDPHUQHFOV-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Dibromopyridine?
The canonical SMILES of 2,5-Dibromopyridine is C1=CC(=NC=C1Br)Br.
What is the CAS number of 2,5-Dibromopyridine?
The CAS number of 2,5-Dibromopyridine is 624-28-2.
What is the European Community (EC) number of 2,5-Dibromopyridine?
The European Community (EC) number of 2,5-Dibromopyridine is 210-839-6.
What is the DSSTox Substance ID of 2,5-Dibromopyridine?
The DSSTox Substance ID of 2,5-Dibromopyridine is DTXSID00211452.
What is the XLogP3-AA value of 2,5-Dibromopyridine?
The XLogP3-AA value of 2,5-Dibromopyridine is 2.6.