What is the molecular formula of 2,5-Dibromopiperidine?
The molecular formula of 2,5-Dibromopiperidine is C5H9Br2N.
What is the molecular weight of 2,5-Dibromopiperidine?
The molecular weight of 2,5-Dibromopiperidine is 242.94 g/mol.
What is the IUPAC name of 2,5-Dibromopiperidine?
The IUPAC name of 2,5-Dibromopiperidine is 2,5-dibromopiperidine.
What is the InChI code of 2,5-Dibromopiperidine?
The InChI code of 2,5-Dibromopiperidine is InChI=1S/C5H9Br2N/c6-4-1-2-5(7)8-3-4/h4-5,8H,1-3H2.
What is the InChIKey of 2,5-Dibromopiperidine?
The InChIKey of 2,5-Dibromopiperidine is HCTZZEWTUFVJMV-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Dibromopiperidine?
The canonical SMILES of 2,5-Dibromopiperidine is C1CC(NCC1Br)Br.
What is the XLogP3-AA value of 2,5-Dibromopiperidine?
The XLogP3-AA value of 2,5-Dibromopiperidine is 2.
How many hydrogen bond donor counts does 2,5-Dibromopiperidine have?
2,5-Dibromopiperidine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2,5-Dibromopiperidine have?
2,5-Dibromopiperidine has 1 hydrogen bond acceptor count.
How many rotatable bond counts does 2,5-Dibromopiperidine have?
2,5-Dibromopiperidine has 0 rotatable bond count.