What is the molecular formula of 2,5-Dibromo-p-xylene?
The molecular formula of 2,5-Dibromo-p-xylene is C8H8Br2.
What is the molecular weight of 2,5-Dibromo-p-xylene?
The molecular weight of 2,5-Dibromo-p-xylene is 263.96 g/mol.
What is the IUPAC name of 2,5-Dibromo-p-xylene?
The IUPAC name of 2,5-Dibromo-p-xylene is 1,4-dibromo-2,5-dimethylbenzene.
What is the InChI of 2,5-Dibromo-p-xylene?
The InChI of 2,5-Dibromo-p-xylene is InChI=1S/C8H8Br2/c1-5-3-8(10)6(2)4-7(5)9/h3-4H,1-2H3.
What is the InChIKey of 2,5-Dibromo-p-xylene?
The InChIKey of 2,5-Dibromo-p-xylene is QENIALCDPFDFHX-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Dibromo-p-xylene?
The canonical SMILES of 2,5-Dibromo-p-xylene is CC1=CC(=C(C=C1Br)C)Br.
What is the CAS number of 2,5-Dibromo-p-xylene?
The CAS number of 2,5-Dibromo-p-xylene is 1074-24-4.
What is the European Community (EC) number of 2,5-Dibromo-p-xylene?
The European Community (EC) number of 2,5-Dibromo-p-xylene is 214-038-2.
What is the DSSTox Substance ID of 2,5-Dibromo-p-xylene?
The DSSTox Substance ID of 2,5-Dibromo-p-xylene is DTXSID9061467.
What is the formal charge of 2,5-Dibromo-p-xylene?
The formal charge of 2,5-Dibromo-p-xylene is 0.