2,5-Dibromo-3-nitro-4-picoline

• Catalog Number: ACM947534692
• Product Name: 2,5-Dibromo-3-nitro-4-picoline
• CAS: 947534-69-2
• Category: Bromine Series
• Synonyms: 2,5-Dibromo-4-methyl-3-nitropyridine
• Molecular Weight: 295.91616
• Molecular Formula: C₆H₄Br₂N₂O₂

Custom Q&A

What is the molecular formula of 2,5-Dibromo-3-nitro-4-picoline?

The molecular formula of 2,5-Dibromo-3-nitro-4-picoline is C6H4Br2N2O2.

What is the molecular weight of 2,5-Dibromo-3-nitro-4-picoline?

The molecular weight of 2,5-Dibromo-3-nitro-4-picoline is 295.92 g/mol.

What is the IUPAC name of 2,5-Dibromo-3-nitro-4-picoline?

The IUPAC name of 2,5-Dibromo-3-nitro-4-picoline is 2,5-dibromo-4-methyl-3-nitropyridine.

What is the InChI of 2,5-Dibromo-3-nitro-4-picoline?

The InChI of 2,5-Dibromo-3-nitro-4-picoline is InChI=1S/C6H4Br2N2O2/c1-3-4(7)2-9-6(8)5(3)10(11)12/h2H,1H3.

What is the InChIKey of 2,5-Dibromo-3-nitro-4-picoline?

The InChIKey of 2,5-Dibromo-3-nitro-4-picoline is MFWWZPPJIRAWSL-UHFFFAOYSA-N.

What is the Canonical SMILES of 2,5-Dibromo-3-nitro-4-picoline?

The Canonical SMILES of 2,5-Dibromo-3-nitro-4-picoline is CC1=C(C(=NC=C1Br)Br)[N+](=O)[O-].

What is the CAS number of 2,5-Dibromo-3-nitro-4-picoline?

The CAS number of 2,5-Dibromo-3-nitro-4-picoline is 947534-69-2.

What is the XLogP3-AA value of 2,5-Dibromo-3-nitro-4-picoline?

The XLogP3-AA value of 2,5-Dibromo-3-nitro-4-picoline is 2.8.

How many hydrogen bond donor counts does 2,5-Dibromo-3-nitro-4-picoline have?

2,5-Dibromo-3-nitro-4-picoline has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2,5-Dibromo-3-nitro-4-picoline have?

2,5-Dibromo-3-nitro-4-picoline has 3 hydrogen bond acceptor counts.