What is the PubChem CID of 2,5-Di-tert-butylaniline?
The PubChem CID of 2,5-Di-tert-butylaniline is 605488.
What is the molecular formula of 2,5-Di-tert-butylaniline?
The molecular formula of 2,5-Di-tert-butylaniline is C14H23N.
What is the molecular weight of 2,5-Di-tert-butylaniline?
The molecular weight of 2,5-Di-tert-butylaniline is 205.34 g/mol.
What is the IUPAC Name of 2,5-Di-tert-butylaniline?
The IUPAC Name of 2,5-Di-tert-butylaniline is 2,5-ditert-butylaniline.
What is the InChI of 2,5-Di-tert-butylaniline?
The InChI of 2,5-Di-tert-butylaniline is InChI=1S/C14H23N/c1-13(2,3)10-7-8-11(12(15)9-10)14(4,5)6/h7-9H,15H2,1-6H3.
What is the InChIKey of 2,5-Di-tert-butylaniline?
The InChIKey of 2,5-Di-tert-butylaniline is NUZVLYNISQOZOW-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Di-tert-butylaniline?
The canonical SMILES of 2,5-Di-tert-butylaniline is CC(C)(C)C1=CC(=C(C=C1)C(C)(C)C)N.
What is the CAS number of 2,5-Di-tert-butylaniline?
The CAS number of 2,5-Di-tert-butylaniline is 21860-03-7.
What is the European Community (EC) Number of 2,5-Di-tert-butylaniline?
The European Community (EC) Number of 2,5-Di-tert-butylaniline is 625-102-8.
Is 2,5-Di-tert-butylaniline a canonicalized compound?
Yes, 2,5-Di-tert-butylaniline is a canonicalized compound.