What is the molecular formula of Zolimidine?
The molecular formula of Zolimidine is C14H12N2O2S.
What is the molecular weight of Zolimidine?
The molecular weight of Zolimidine is 272.32 g/mol.
What is the IUPAC name of Zolimidine?
The IUPAC name of Zolimidine is 2-(4-methylsulfonylphenyl)imidazo[1,2-a]pyridine.
What is the InChI of Zolimidine?
The InChI of Zolimidine is InChI=1S/C14H12N2O2S/c1-19(17,18)12-7-5-11(6-8-12)13-10-16-9-3-2-4-14(16)15-13/h2-10H,1H3.
What is the InChIKey of Zolimidine?
The InChIKey of Zolimidine is VSLIUWLPFRVCDL-UHFFFAOYSA-N.
What is the canonical SMILES of Zolimidine?
The canonical SMILES of Zolimidine is CS(=O)(=O)C1=CC=C(C=C1)C2=CN3C=CC=CC3=N2.
What is the CAS number of Zolimidine?
The CAS number of Zolimidine is 1222-57-7.
What is the European Community (EC) number of Zolimidine?
The European Community (EC) number of Zolimidine is 214-947-4.
What is the UNII of Zolimidine?
The UNII of Zolimidine is YCF001N8QB.
What is the PubChem CID of Zolimidine?
The PubChem CID of Zolimidine is 14652.