What is the molecular formula of 2,4-Dibromomesitylene?
The molecular formula of 2,4-Dibromomesitylene is C9H10Br2.
What is the molecular weight of 2,4-Dibromomesitylene?
The molecular weight of 2,4-Dibromomesitylene is 277.98 g/mol.
What is the IUPAC name of 2,4-Dibromomesitylene?
The IUPAC name of 2,4-Dibromomesitylene is 2,4-dibromo-1,3,5-trimethylbenzene.
What is the InChI of 2,4-Dibromomesitylene?
The InChI of 2,4-Dibromomesitylene is InChI=1S/C9H10Br2/c1-5-4-6(2)9(11)7(3)8(5)10/h4H,1-3H3.
What is the InChIKey of 2,4-Dibromomesitylene?
The InChIKey of 2,4-Dibromomesitylene is CIHJFEWFZJQTFE-UHFFFAOYSA-N.
What is the CAS number of 2,4-Dibromomesitylene?
The CAS number of 2,4-Dibromomesitylene is 6942-99-0.
What is the XLogP3-AA value of 2,4-Dibromomesitylene?
The XLogP3-AA value of 2,4-Dibromomesitylene is 4.4.
What is the hydrogen bond donor count of 2,4-Dibromomesitylene?
The hydrogen bond donor count of 2,4-Dibromomesitylene is 0.
What is the hydrogen bond acceptor count of 2,4-Dibromomesitylene?
The hydrogen bond acceptor count of 2,4-Dibromomesitylene is 0.
How many rotatable bonds does 2,4-Dibromomesitylene have?
2,4-Dibromomesitylene does not have any rotatable bonds.