What is the molecular formula of 2,4,6-triphenylaniline?
The molecular formula is C24H19N.
What is the molecular weight of 2,4,6-triphenylaniline?
The molecular weight is 321.4 g/mol.
When was 2,4,6-triphenylaniline created?
It was created on March 28, 2005.
When was 2,4,6-triphenylaniline last modified?
It was last modified on November 25, 2023.
What is the IUPAC name of 2,4,6-triphenylaniline?
The IUPAC name is 2,4,6-triphenylaniline.
What is the InChI of 2,4,6-triphenylaniline?
The InChI is InChI=1S/C24H19N/c25-24-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(24)20-14-8-3-9-15-20/h1-17H,25H2.
What is the InChIKey of 2,4,6-triphenylaniline?
The InChIKey is AGWKGKUGJDMKMT-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4,6-triphenylaniline?
The canonical SMILES is C1=CC=C(C=C1)C2=CC(=C(C(=C2)C3=CC=CC=C3)N)C4=CC=CC=C4.
What is the CAS number of 2,4,6-triphenylaniline?
The CAS number is 6864-20-6.
What is the XLogP3-AA value of 2,4,6-triphenylaniline?
The XLogP3-AA value is 6.1.