What is the molecular formula of 2,4,6-Trimethylanisole?
The molecular formula of 2,4,6-Trimethylanisole is C10H14O.
What is another name for 2,4,6-Trimethylanisole?
Another name for 2,4,6-Trimethylanisole is 2-Methoxy-1,3,5-trimethylbenzene.
What is the CAS number of 2,4,6-Trimethylanisole?
The CAS number of 2,4,6-Trimethylanisole is 4028-66-4.
What is the IUPAC name of 2,4,6-Trimethylanisole?
The IUPAC name of 2,4,6-Trimethylanisole is 2-methoxy-1,3,5-trimethylbenzene.
What is the InChI of 2,4,6-Trimethylanisole?
The InChI of 2,4,6-Trimethylanisole is InChI=1S/C10H14O/c1-7-5-8(2)10(11-4)9(3)6-7/h5-6H,1-4H3.
What is the InChIKey of 2,4,6-Trimethylanisole?
The InChIKey of 2,4,6-Trimethylanisole is NNVKEOMPDSKFGZ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4,6-Trimethylanisole?
The canonical SMILES of 2,4,6-Trimethylanisole is CC1=CC(=C(C(=C1)C)OC)C.
What is the XLogP3-AA value of 2,4,6-Trimethylanisole?
The XLogP3-AA value of 2,4,6-Trimethylanisole is 3.
How many hydrogen bond donor counts does 2,4,6-Trimethylanisole have?
2,4,6-Trimethylanisole has 0 hydrogen bond donor counts.
How many rotatable bond counts does 2,4,6-Trimethylanisole have?
2,4,6-Trimethylanisole has the exact number of rotatable bond counts listed.