What is the PubChem CID of 2,4,6-Trifluoroaniline?
The PubChem CID of 2,4,6-Trifluoroaniline is 67765.
What is the chemical structure of 2,4,6-Trifluoroaniline?
The chemical structure of 2,4,6-Trifluoroaniline is C6H4F3N.
What is the molecular formula of 2,4,6-Trifluoroaniline?
The molecular formula of 2,4,6-Trifluoroaniline is C6H4F3N.
What is the molecular weight of 2,4,6-Trifluoroaniline?
The molecular weight of 2,4,6-Trifluoroaniline is 147.10 g/mol.
What are the synonyms of 2,4,6-Trifluoroaniline?
The synonyms of 2,4,6-Trifluoroaniline are 2-Amino-1,3,5-trifluorobenzene and Benzenamine, 2,4,6-trifluoro-.
What is the IUPAC name of 2,4,6-Trifluoroaniline?
The IUPAC name of 2,4,6-Trifluoroaniline is 2,4,6-trifluoroaniline.
What is the InChI of 2,4,6-Trifluoroaniline?
The InChI of 2,4,6-Trifluoroaniline is InChI=1S/C6H4F3N/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2.
What is the InChIKey of 2,4,6-Trifluoroaniline?
The InChIKey of 2,4,6-Trifluoroaniline is BJSVKBGQDHUBHZ-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,4,6-Trifluoroaniline?
The Canonical SMILES of 2,4,6-Trifluoroaniline is C1=C(C=C(C(=C1F)N)F)F.
What is the CAS number of 2,4,6-Trifluoroaniline?
The CAS number of 2,4,6-Trifluoroaniline is 363-81-5.