What is the molecular formula of 2,4,5-Tb?
The molecular formula of 2,4,5-Tb is C10H9Cl3O3.
What is the molecular weight of 2,4,5-Tb?
The molecular weight of 2,4,5-Tb is 283.5 g/mol.
What is the IUPAC name of 2,4,5-Tb?
The IUPAC name of 2,4,5-Tb is 4-(2,4,5-trichlorophenoxy)butanoic acid.
What is the InChI of 2,4,5-Tb?
The InChI of 2,4,5-Tb is InChI=1S/C10H9Cl3O3/c11-6-4-8(13)9(5-7(6)12)16-3-1-2-10(14)15/h4-5H,1-3H2,(H,14,15).
What is the InChIKey of 2,4,5-Tb?
The InChIKey of 2,4,5-Tb is RTWCZQFXFMXXKP-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4,5-Tb?
The canonical SMILES of 2,4,5-Tb is C1=C(C(=CC(=C1Cl)Cl)Cl)OCCCC(=O)O.
What is the CAS number of 2,4,5-Tb?
The CAS number of 2,4,5-Tb is 93-80-1.
What is the European Community (EC) number of 2,4,5-Tb?
The European Community (EC) number of 2,4,5-Tb is 202-278-0.
What is the UNII of 2,4,5-Tb?
The UNII of 2,4,5-Tb is 8JM4UCP94P.
Is 2,4,5-Tb a canonicalized compound?
Yes, 2,4,5-Tb is a canonicalized compound.